C10H12F2N2OS — CID 12992868
1-[(2,6-difluorophenyl)methyl]-3-(2-hydroxyethyl)thiourea (PubChem CID 12992868) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-3-(2-hydroxyethyl)thiourea.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-3-(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 12992868 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-3-(2-hydroxyethyl)thiourea |
| SMILES | OCCNC(=S)NCc1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2OS/c11-8-2-1-3-9(12)7(8)6-14-10(16)13-4-5-15/h1-3,15H,4-6H2,(H2,13,14,16) |
| InChIKey | WVMHPHLXDXQJAL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|