C23H21N3O3S2 — CID 1299309
(6S)-2-(4-methoxyphenyl)imino-4-oxo-N-phenyl-3-(thiophen-2-ylmethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 1299309) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (6S)-2-(4-methoxyphenyl)imino-4-oxo-N-phenyl-3-(thiophen-2-ylmethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-2-(4-methoxyphenyl)imino-4-oxo-N-phenyl-3-(thiophen-2-ylmethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 1299309 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (6S)-2-(4-methoxyphenyl)imino-4-oxo-N-phenyl-3-(thiophen-2-ylmethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(/N=C2\S[C@H](C(=O)Nc3ccccc3)CC(=O)N2Cc2cccs2)cc1 |
| InChI | InChI=1S/C23H21N3O3S2/c1-29-18-11-9-17(10-12-18)25-23-26(15-19-8-5-13-30-19)21(27)14-20(31-23)22(28)24-16-6-3-2-4-7-16/h2-13,20H,14-15H2,1H3,(H,24,28)/b25-23-/t20-/m0/s1 |
| InChIKey | OQGUIDHTXCAROZ-ZPKJPUMHSA-N |
| XLogP | 4.92 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|