About 2-(1-adamantyl)hexanal
2-(1-adamantyl)hexanal (PubChem CID 12993244) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-(1-adamantyl)hexanal.
Molecular Properties
| Compound Name | 2-(1-adamantyl)hexanal |
| PubChem CID | 12993244 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2-(1-adamantyl)hexanal |
| SMILES | CCCCC(C=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26O/c1-2-3-4-15(11-17)16-8-12-5-13(9-16)7-14(6-12)10-16/h11-15H,2-10H2,1H3 |
| InChIKey | YNRMVRZUEWRXDZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)hexanal?
The IUPAC name of 2-(1-adamantyl)hexanal (CID 12993244) is 2-(1-adamantyl)hexanal.
What is the SMILES notation for 2-(1-adamantyl)hexanal?
The canonical SMILES for 2-(1-adamantyl)hexanal is CCCCC(C=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)hexanal?
The InChIKey is YNRMVRZUEWRXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-2-3-4-15(11-17)16-8-12-5-13(9-16)7-14(6-12)10-16/h11-15H,2-10H2,1H3.
What are the key properties of 2-(1-adamantyl)hexanal?
2-(1-adamantyl)hexanal has a molecular weight of 234.38 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)hexanal is sourced from PubChem (CID 12993244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).