C22H20O5 — CID 12993496
(2R,11S)-6-methoxy-12,12-dimethyl-9,13,15-trioxapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(14),3(8),4,6,16,18,20-heptaen-22-one (PubChem CID 12993496) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2R,11S)-6-methoxy-12,12-dimethyl-9,13,15-trioxapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(14),3(8),4,6,16,18,20-heptaen-22-one.
| Compound Name | (2R,11S)-6-methoxy-12,12-dimethyl-9,13,15-trioxapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(14),3(8),4,6,16,18,20-heptaen-22-one |
|---|---|
| PubChem CID | 12993496 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2R,11S)-6-methoxy-12,12-dimethyl-9,13,15-trioxapentacyclo[12.8.0.02,11.03,8.016,21]docosa-1(14),3(8),4,6,16,18,20-heptaen-22-one |
| SMILES | COc1ccc2c(c1)OC[C@@H]1[C@H]2c2c(oc3ccccc3c2=O)OC1(C)C |
| InChI | InChI=1S/C22H20O5/c1-22(2)15-11-25-17-10-12(24-3)8-9-13(17)18(15)19-20(23)14-6-4-5-7-16(14)26-21(19)27-22/h4-10,15,18H,11H2,1-3H3/t15-,18+/m1/s1 |
| InChIKey | JINJDDLHPMEQBX-QAPCUYQASA-N |
| XLogP | 4.11 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |