C17H36 — CID 12993532
(5S,9R)-5,9-dimethylpentadecane (PubChem CID 12993532) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is (5S,9R)-5,9-dimethylpentadecane.
| Compound Name | (5S,9R)-5,9-dimethylpentadecane |
|---|---|
| PubChem CID | 12993532 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | (5S,9R)-5,9-dimethylpentadecane |
| SMILES | CCCCCC[C@@H](C)CCC[C@@H](C)CCCC |
| InChI | InChI=1S/C17H36/c1-5-7-9-10-13-17(4)15-11-14-16(3)12-8-6-2/h16-17H,5-15H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | XTTUZCLEOCTJKO-DLBZAZTESA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|