C7H9N3O2 — CID 129935352
1,2-Dimethyl-6-oxopyrimidine-5-carboxamide (PubChem CID 129935352) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 1,2-dimethyl-6-oxopyrimidine-5-carboxamide.
| Compound Name | 1,2-Dimethyl-6-oxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 129935352 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1,2-dimethyl-6-oxopyrimidine-5-carboxamide |
| SMILES | CC1=NC=C(C(=O)N1C)C(=O)N |
| InChI | InChI=1S/C7H9N3O2/c1-4-9-3-5(6(8)11)7(12)10(4)2/h3H,1-2H3,(H2,8,11) |
| InChIKey | YUBOKUJLWWEJST-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 304 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |