C20H20Cl2N4O4 — CID 12993709
(2Z)-1-cyclopropyl-3-[2,4-dichloro-3-[(4-cyclopropyl-5-oxotetrazol-1-yl)methyl]phenyl]-2-(ethoxymethylidene)propane-1,3-dione (PubChem CID 12993709) has the molecular formula C20H20Cl2N4O4 and a molecular weight of 451.31 g/mol. Its IUPAC name is (2Z)-1-cyclopropyl-3-[2,4-dichloro-3-[(4-cyclopropyl-5-oxotetrazol-1-yl)methyl]phenyl]-2-(ethoxymethylidene)propane-1,3-dione.
| Compound Name | (2Z)-1-cyclopropyl-3-[2,4-dichloro-3-[(4-cyclopropyl-5-oxotetrazol-1-yl)methyl]phenyl]-2-(ethoxymethylidene)propane-1,3-dione |
|---|---|
| PubChem CID | 12993709 |
| Molecular Formula | C20H20Cl2N4O4 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (2Z)-1-cyclopropyl-3-[2,4-dichloro-3-[(4-cyclopropyl-5-oxotetrazol-1-yl)methyl]phenyl]-2-(ethoxymethylidene)propane-1,3-dione |
| SMILES | CCO/C=C(\C(=O)c1ccc(Cl)c(Cn2nnn(C3CC3)c2=O)c1Cl)C(=O)C1CC1 |
| InChI | InChI=1S/C20H20Cl2N4O4/c1-2-30-10-15(18(27)11-3-4-11)19(28)13-7-8-16(21)14(17(13)22)9-25-20(29)26(24-23-25)12-5-6-12/h7-8,10-12H,2-6,9H2,1H3/b15-10- |
| InChIKey | BGVQQLFIQPNJCQ-GDNBJRDFSA-N |
| XLogP | 3.21 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|