C20H15ClN4O3S2 — CID 1299396
2-[[5-(3-chloro-1-benzothiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone (PubChem CID 1299396) has the molecular formula C20H15ClN4O3S2 and a molecular weight of 458.95 g/mol. Its IUPAC name is 2-[[5-(3-chloro-1-benzothiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[[5-(3-chloro-1-benzothiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 1299396 |
| Molecular Formula | C20H15ClN4O3S2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 2-[[5-(3-chloro-1-benzothiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-nitrophenyl)ethanone |
| SMILES | CCn1c(SCC(=O)c2ccc([N+](=O)[O-])cc2)nnc1-c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H15ClN4O3S2/c1-2-24-19(18-17(21)14-5-3-4-6-16(14)30-18)22-23-20(24)29-11-15(26)12-7-9-13(10-8-12)25(27)28/h3-10H,2,11H2,1H3 |
| InChIKey | FEZHYTQJXXVBMA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|