C10H9F6N — CID 12994031
4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methylaniline (PubChem CID 12994031) has the molecular formula C10H9F6N and a molecular weight of 257.18 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methylaniline.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methylaniline |
|---|---|
| PubChem CID | 12994031 |
| Molecular Formula | C10H9F6N |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methylaniline |
| SMILES | Cc1cc(N)ccc1C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F6N/c1-5-4-6(17)2-3-7(5)8(9(11,12)13)10(14,15)16/h2-4,8H,17H2,1H3 |
| InChIKey | BWXMSMSAOVYSNJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|