About 2-fluoro-4-methylpentane
2-fluoro-4-methylpentane (PubChem CID 12994092) has the molecular formula C6H13F
and a molecular weight of 104.17 g/mol. Its IUPAC name is 2-fluoro-4-methylpentane.
Molecular Properties
| Compound Name | 2-fluoro-4-methylpentane |
| PubChem CID | 12994092 |
| Molecular Formula | C6H13F |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.10 |
| IUPAC Name | 2-fluoro-4-methylpentane |
| SMILES | CC(C)CC(C)F |
| InChI | InChI=1S/C6H13F/c1-5(2)4-6(3)7/h5-6H,4H2,1-3H3 |
| InChIKey | BYHGATRUPQLTMH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-4-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methylpentane?
The IUPAC name of 2-fluoro-4-methylpentane (CID 12994092) is 2-fluoro-4-methylpentane.
What is the SMILES notation for 2-fluoro-4-methylpentane?
The canonical SMILES for 2-fluoro-4-methylpentane is CC(C)CC(C)F.
What is the InChIKey of 2-fluoro-4-methylpentane?
The InChIKey is BYHGATRUPQLTMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F/c1-5(2)4-6(3)7/h5-6H,4H2,1-3H3.
What are the key properties of 2-fluoro-4-methylpentane?
2-fluoro-4-methylpentane has a molecular weight of 104.17 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methylpentane is sourced from PubChem (CID 12994092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).