About N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide
N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide (PubChem CID 12994776) has the molecular formula C11H7BrCl3N3O2
and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide |
| PubChem CID | 12994776 |
| Molecular Formula | C11H7BrCl3N3O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 396.88 |
| IUPAC Name | N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide |
| SMILES | CC(=O)NC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1Br |
| InChI | InChI=1S/C11H7BrCl3N3O2/c1-4(19)16-10-8(12)11(20)18(17-10)9-6(14)2-5(13)3-7(9)15/h2-3,8H,1H3,(H,16,17,19) |
| InChIKey | NOSBYSIPCLTSEF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide?
The IUPAC name of N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide (CID 12994776) is N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide.
What is the SMILES notation for N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide?
The canonical SMILES for N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide is CC(=O)NC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1Br.
What is the InChIKey of N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide?
The InChIKey is NOSBYSIPCLTSEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrCl3N3O2/c1-4(19)16-10-8(12)11(20)18(17-10)9-6(14)2-5(13)3-7(9)15/h2-3,8H,1H3,(H,16,17,19).
What are the key properties of N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide?
N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide has a molecular weight of 399.46 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-bromo-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]acetamide is sourced from PubChem (CID 12994776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).