C18H34O4Si — CID 12994838
(6R,8R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2,2,11-trimethyl-1,3-dioxaspiro[5.5]undec-9-en-11-ol (PubChem CID 12994838) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is (6R,8R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2,2,11-trimethyl-1,3-dioxaspiro[5.5]undec-9-en-11-ol.
| Compound Name | (6R,8R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2,2,11-trimethyl-1,3-dioxaspiro[5.5]undec-9-en-11-ol |
|---|---|
| PubChem CID | 12994838 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (6R,8R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2,2,11-trimethyl-1,3-dioxaspiro[5.5]undec-9-en-11-ol |
| SMILES | CC1(C)OCC[C@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C=C[C@]2(C)O)O1 |
| InChI | InChI=1S/C18H34O4Si/c1-15(2,3)23(7,8)21-14-9-10-17(6,19)18(13-14)11-12-20-16(4,5)22-18/h9-10,14,19H,11-13H2,1-8H3/t14-,17-,18+/m0/s1 |
| InChIKey | GRYGSRBBIVKYRO-JCGIZDLHSA-N |
| XLogP | 4.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|