C14H23NO2 — CID 12995001
(2R,3R)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-ethenyl-2-methylhexan-1-one (PubChem CID 12995001) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2R,3R)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-ethenyl-2-methylhexan-1-one.
| Compound Name | (2R,3R)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-ethenyl-2-methylhexan-1-one |
|---|---|
| PubChem CID | 12995001 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2R,3R)-1-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-ethenyl-2-methylhexan-1-one |
| SMILES | C=C[C@@H](CCC)[C@@H](C)C(=O)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C14H23NO2/c1-6-8-11(7-2)10(3)12(16)13-15-14(4,5)9-17-13/h7,10-11H,2,6,8-9H2,1,3-5H3/t10-,11+/m1/s1 |
| InChIKey | FIAVLXOWJTWGKP-MNOVXSKESA-N |
| XLogP | 3.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|