C20H28N4O3 — CID 12995137
N-(6,8-dioxo-7-propyl-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidin-9-yl)tricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 12995137) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(6,8-dioxo-7-propyl-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidin-9-yl)tricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | N-(6,8-dioxo-7-propyl-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidin-9-yl)tricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 12995137 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-(6,8-dioxo-7-propyl-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidin-9-yl)tricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | CCCn1c(=O)c(NC(=O)C23CC4CC(CC2C4)C3)c2n(c1=O)CCCN2 |
| InChI | InChI=1S/C20H28N4O3/c1-2-5-24-17(25)15(16-21-4-3-6-23(16)19(24)27)22-18(26)20-10-12-7-13(11-20)9-14(20)8-12/h12-14,21H,2-11H2,1H3,(H,22,26) |
| InChIKey | IEBRCKXPMMOGAV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |