C19H15F2N3O2 — CID 12995194
1-[(1S,2R)-2-(3,4-difluorophenyl)cyclopent-3-en-1-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 12995194) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(3,4-difluorophenyl)cyclopent-3-en-1-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-[(1S,2R)-2-(3,4-difluorophenyl)cyclopent-3-en-1-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 12995194 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[(1S,2R)-2-(3,4-difluorophenyl)cyclopent-3-en-1-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH]n([C@H]2CC=C[C@@H]2c2ccc(F)c(F)c2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C19H15F2N3O2/c20-15-10-9-12(11-16(15)21)14-7-4-8-17(14)24-19(26)23(18(25)22-24)13-5-2-1-3-6-13/h1-7,9-11,14,17H,8H2,(H,22,25)/t14-,17+/m1/s1 |
| InChIKey | YQDLTUGRJGYFPO-PBHICJAKSA-N |
| XLogP | 2.89 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|