C27H17Cl2NO8 — CID 12995851
(3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 12995851) has the molecular formula C27H17Cl2NO8 and a molecular weight of 554.34 g/mol. Its IUPAC name is (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 12995851 |
| Molecular Formula | C27H17Cl2NO8 |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@H]1[C@@H](c2ccc(Cl)c(Cl)c2)OC2(C(=O)c3ccccc3C2=O)[C@H]1C(=O)O |
| InChI | InChI=1S/C27H17Cl2NO8/c28-16-7-5-12(9-17(16)29)22-20(25(33)30-13-6-8-18-19(10-13)37-11-36-18)21(26(34)35)27(38-22)23(31)14-3-1-2-4-15(14)24(27)32/h1-10,20-22H,11H2,(H,30,33)(H,34,35)/t20-,21-,22-/m1/s1 |
| InChIKey | SCNAEUUVEJJBIN-YPAWHYETSA-N |
| XLogP | 4.57 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|