C17H38OSi2 — CID 12996060
tert-butyl-dimethyl-[(E)-5-triethylsilylpent-4-enoxy]silane (PubChem CID 12996060) has the molecular formula C17H38OSi2 and a molecular weight of 314.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-5-triethylsilylpent-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-5-triethylsilylpent-4-enoxy]silane |
|---|---|
| PubChem CID | 12996060 |
| Molecular Formula | C17H38OSi2 |
| Molecular Weight | 314.66 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-5-triethylsilylpent-4-enoxy]silane |
| SMILES | CC[Si](/C=C/CCCO[Si](C)(C)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C17H38OSi2/c1-9-20(10-2,11-3)16-14-12-13-15-18-19(7,8)17(4,5)6/h14,16H,9-13,15H2,1-8H3/b16-14+ |
| InChIKey | FFZFUWNOIDMIEE-JQIJEIRASA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|