About CID 12996076
CID 12996076 (PubChem CID 12996076) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol.
Molecular Properties
| Compound Name | CID 12996076 |
| PubChem CID | 12996076 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | — |
| SMILES | C1COC2(CC[C@H]3[C@@H]2CC[C@]32CO2)O1 |
| InChI | InChI=1S/C11H16O3/c1-3-10(7-14-10)8-2-4-11(9(1)8)12-5-6-13-11/h8-9H,1-7H2/t8-,9-,10-/m0/s1 |
| InChIKey | SHMKWSUXGBGPGR-GUBZILKMSA-N |
| XLogP | 1.32 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 12996076 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12996076?
The IUPAC name of CID 12996076 (CID 12996076) is not available.
What is the SMILES notation for CID 12996076?
The canonical SMILES for CID 12996076 is C1COC2(CC[C@H]3[C@@H]2CC[C@]32CO2)O1.
What is the InChIKey of CID 12996076?
The InChIKey is SHMKWSUXGBGPGR-GUBZILKMSA-N. The full InChI is InChI=1S/C11H16O3/c1-3-10(7-14-10)8-2-4-11(9(1)8)12-5-6-13-11/h8-9H,1-7H2/t8-,9-,10-/m0/s1.
What are the key properties of CID 12996076?
CID 12996076 has a molecular weight of 196.25 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12996076 is sourced from PubChem (CID 12996076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).