About N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine
N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine (PubChem CID 12996153) has the molecular formula C9H17N2P
and a molecular weight of 184.22 g/mol. Its IUPAC name is N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine |
| PubChem CID | 12996153 |
| Molecular Formula | C9H17N2P |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine |
| SMILES | CN(C)P(C1=CC=CC1)N(C)C |
| InChI | InChI=1S/C9H17N2P/c1-10(2)12(11(3)4)9-7-5-6-8-9/h5-7H,8H2,1-4H3 |
| InChIKey | IISSPFPXOURYBQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine?
The IUPAC name of N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine (CID 12996153) is N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine.
What is the SMILES notation for N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine?
The canonical SMILES for N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine is CN(C)P(C1=CC=CC1)N(C)C.
What is the InChIKey of N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine?
The InChIKey is IISSPFPXOURYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2P/c1-10(2)12(11(3)4)9-7-5-6-8-9/h5-7H,8H2,1-4H3.
What are the key properties of N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine?
N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine has a molecular weight of 184.22 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopenta-1,3-dien-1-yl(dimethylamino)phosphanyl]-N-methylmethanamine is sourced from PubChem (CID 12996153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).