C11H22O2SSi2 — CID 12996447
(1R,5S,6R,7R)-6,7-bis(trimethylsilyl)-2,4-dioxabicyclo[3.2.0]heptane-3-thione (PubChem CID 12996447) has the molecular formula C11H22O2SSi2 and a molecular weight of 274.53 g/mol. Its IUPAC name is (1R,5S,6R,7R)-6,7-bis(trimethylsilyl)-2,4-dioxabicyclo[3.2.0]heptane-3-thione.
| Compound Name | (1R,5S,6R,7R)-6,7-bis(trimethylsilyl)-2,4-dioxabicyclo[3.2.0]heptane-3-thione |
|---|---|
| PubChem CID | 12996447 |
| Molecular Formula | C11H22O2SSi2 |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (1R,5S,6R,7R)-6,7-bis(trimethylsilyl)-2,4-dioxabicyclo[3.2.0]heptane-3-thione |
| SMILES | C[Si](C)(C)[C@@H]1[C@@H]2OC(=S)O[C@@H]2[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C11H22O2SSi2/c1-15(2,3)9-7-8(13-11(14)12-7)10(9)16(4,5)6/h7-10H,1-6H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | CDXVTCTZZJGIRD-UTINFBMNSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|