C28H40S4Si5 — CID 12996450
trimethyl-[4',10,10'-tris(trimethylsilyl)-7,7'-spirobi[3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4-yl]silane (PubChem CID 12996450) has the molecular formula C28H40S4Si5 and a molecular weight of 645.33 g/mol. Its IUPAC name is trimethyl-[4',10,10'-tris(trimethylsilyl)-7,7'-spirobi[3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4-yl]silane.
| Compound Name | trimethyl-[4',10,10'-tris(trimethylsilyl)-7,7'-spirobi[3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4-yl]silane |
|---|---|
| PubChem CID | 12996450 |
| Molecular Formula | C28H40S4Si5 |
| Molecular Weight | 645.33 g/mol |
| Exact Mass | 644.09 |
| IUPAC Name | trimethyl-[4',10,10'-tris(trimethylsilyl)-7,7'-spirobi[3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene]-4-yl]silane |
| SMILES | C[Si](C)(C)c1cc2c(s1)-c1sc([Si](C)(C)C)cc1[Si]21c2cc([Si](C)(C)C)sc2-c2sc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C28H40S4Si5/c1-33(2,3)21-13-17-25(29-21)26-18(14-22(30-26)34(4,5)6)37(17)19-15-23(35(7,8)9)31-27(19)28-20(37)16-24(32-28)36(10,11)12/h13-16H,1-12H3 |
| InChIKey | UWHUSUCTMWCOQA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|