About 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one
5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one (PubChem CID 12996700) has the molecular formula C21H18N2O
and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one |
| PubChem CID | 12996700 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one |
| SMILES | C=C/C=C/c1c(C)nc(-c2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H18N2O/c1-3-4-15-19-16(2)22-20(17-11-7-5-8-12-17)23(21(19)24)18-13-9-6-10-14-18/h3-15H,1H2,2H3/b15-4+ |
| InChIKey | ZQQLWPPZIIKRSQ-SYZQJQIISA-N |
| XLogP | 4.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one?
The IUPAC name of 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one (CID 12996700) is 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one.
What is the SMILES notation for 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one?
The canonical SMILES for 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one is C=C/C=C/c1c(C)nc(-c2ccccc2)n(-c2ccccc2)c1=O.
What is the InChIKey of 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one?
The InChIKey is ZQQLWPPZIIKRSQ-SYZQJQIISA-N. The full InChI is InChI=1S/C21H18N2O/c1-3-4-15-19-16(2)22-20(17-11-7-5-8-12-17)23(21(19)24)18-13-9-6-10-14-18/h3-15H,1H2,2H3/b15-4+.
What are the key properties of 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one?
5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one has a molecular weight of 314.39 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1E)-buta-1,3-dienyl]-6-methyl-2,3-diphenylpyrimidin-4-one is sourced from PubChem (CID 12996700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).