C40H76N12O8 — CID 12997587
N-(2-morpholin-4-ylethyl)-2-[4,7,10-tris[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 12997587) has the molecular formula C40H76N12O8 and a molecular weight of 853.12 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-[4,7,10-tris[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-[4,7,10-tris[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 12997587 |
| Molecular Formula | C40H76N12O8 |
| Molecular Weight | 853.12 g/mol |
| Exact Mass | 852.59 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-[4,7,10-tris[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)NCCN2CCOCC2)CCN(CC(=O)NCCN2CCOCC2)CCN(CC(=O)NCCN2CCOCC2)CC1)NCCN1CCOCC1 |
| InChI | InChI=1S/C40H76N12O8/c53-37(41-1-5-45-17-25-57-26-18-45)33-49-9-11-50(34-38(54)42-2-6-46-19-27-58-28-20-46)13-15-52(36-40(56)44-4-8-48-23-31-60-32-24-48)16-14-51(12-10-49)35-39(55)43-3-7-47-21-29-59-30-22-47/h1-36H2,(H,41,53)(H,42,54)(H,43,55)(H,44,56) |
| InChIKey | IMNSSGAWPKUZNO-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.12 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |