C15H20N2O6 — CID 12997612
6,7-dimethyl-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-quinoxaline-2,3-dione (PubChem CID 12997612) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 6,7-dimethyl-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-quinoxaline-2,3-dione.
| Compound Name | 6,7-dimethyl-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 12997612 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6,7-dimethyl-4-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-quinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C |
| InChI | InChI=1S/C15H20N2O6/c1-7-3-9-10(4-8(7)2)17(15(23)14(22)16-9)5-11(19)13(21)12(20)6-18/h3-4,11-13,18-21H,5-6H2,1-2H3,(H,16,22)/t11-,12+,13-/m0/s1 |
| InChIKey | SLOQSNHEHSCLGS-XQQFMLRXSA-N |
| XLogP | -1.62 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|