C20H11ClFN3O — CID 12997800
4-(2-chlorophenyl)-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 12997800) has the molecular formula C20H11ClFN3O and a molecular weight of 363.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-(2-chlorophenyl)-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 12997800 |
| Molecular Formula | C20H11ClFN3O |
| Molecular Weight | 363.78 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-(2-chlorophenyl)-15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=c1[nH]ccc2c3nc(-c4ccccc4Cl)[nH]c3c3ccc(F)cc3c12 |
| InChI | InChI=1S/C20H11ClFN3O/c21-15-4-2-1-3-12(15)19-24-17-11-6-5-10(22)9-14(11)16-13(18(17)25-19)7-8-23-20(16)26/h1-9H,(H,23,26)(H,24,25) |
| InChIKey | JYYPZVBYHBGFJH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|