C10H19N3O4 — CID 12997860
1,4-dioxa-7,10,13-triazacyclopentadecane-8,12-dione (PubChem CID 12997860) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1,4-dioxa-7,10,13-triazacyclopentadecane-8,12-dione.
| Compound Name | 1,4-dioxa-7,10,13-triazacyclopentadecane-8,12-dione |
|---|---|
| PubChem CID | 12997860 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1,4-dioxa-7,10,13-triazacyclopentadecane-8,12-dione |
| SMILES | O=C1CNCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C10H19N3O4/c14-9-7-11-8-10(15)13-2-4-17-6-5-16-3-1-12-9/h11H,1-8H2,(H,12,14)(H,13,15) |
| InChIKey | QFHRFCZENKEAEQ-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |