About 3-nitroxanthene-9-thione
3-nitroxanthene-9-thione (PubChem CID 12998438) has the molecular formula C13H7NO3S
and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-nitroxanthene-9-thione.
Molecular Properties
| Compound Name | 3-nitroxanthene-9-thione |
| PubChem CID | 12998438 |
| Molecular Formula | C13H7NO3S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-nitroxanthene-9-thione |
| SMILES | O=[N+]([O-])c1ccc2c(=S)c3ccccc3oc2c1 |
| InChI | InChI=1S/C13H7NO3S/c15-14(16)8-5-6-10-12(7-8)17-11-4-2-1-3-9(11)13(10)18/h1-7H |
| InChIKey | QMOWSYVDJFZEID-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroxanthene-9-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroxanthene-9-thione?
The IUPAC name of 3-nitroxanthene-9-thione (CID 12998438) is 3-nitroxanthene-9-thione.
What is the SMILES notation for 3-nitroxanthene-9-thione?
The canonical SMILES for 3-nitroxanthene-9-thione is O=[N+]([O-])c1ccc2c(=S)c3ccccc3oc2c1.
What is the InChIKey of 3-nitroxanthene-9-thione?
The InChIKey is QMOWSYVDJFZEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7NO3S/c15-14(16)8-5-6-10-12(7-8)17-11-4-2-1-3-9(11)13(10)18/h1-7H.
What are the key properties of 3-nitroxanthene-9-thione?
3-nitroxanthene-9-thione has a molecular weight of 257.27 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroxanthene-9-thione is sourced from PubChem (CID 12998438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).