C8H13NS — CID 12998651
3,4,5,6,7,8-hexahydro-2H-1,4-benzothiazine (PubChem CID 12998651) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexahydro-2H-1,4-benzothiazine.
| Compound Name | 3,4,5,6,7,8-hexahydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 12998651 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3,4,5,6,7,8-hexahydro-2H-1,4-benzothiazine |
| SMILES | C1CCC2=C(C1)NCCS2 |
| InChI | InChI=1S/C8H13NS/c1-2-4-8-7(3-1)9-5-6-10-8/h9H,1-6H2 |
| InChIKey | FLIFVJFYTIANOM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |