C13H15NO — CID 12999871
3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole (PubChem CID 12999871) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole.
| Compound Name | 3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 12999871 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-phenyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
| SMILES | c1ccc(C2=NOC3CCCCC23)cc1 |
| InChI | InChI=1S/C13H15NO/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13/h1-3,6-7,11-12H,4-5,8-9H2 |
| InChIKey | RSAWVZJBIQEIGU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |