About 1,2,4-trichlorobenzene
1,2,4-trichlorobenzene (PubChem CID 13) has the molecular formula C6H3Cl3
and a molecular weight of 181.45 g/mol. Its IUPAC name is 1,2,4-trichlorobenzene.
Molecular Properties
| Compound Name | 1,2,4-trichlorobenzene |
| PubChem CID | 13 |
| Molecular Formula | C6H3Cl3 |
| Molecular Weight | 181.45 g/mol |
| Exact Mass | 179.93 |
| IUPAC Name | 1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | PBKONEOXTCPAFI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trichlorobenzene?
The IUPAC name of 1,2,4-trichlorobenzene (CID 13) is 1,2,4-trichlorobenzene.
What is the SMILES notation for 1,2,4-trichlorobenzene?
The canonical SMILES for 1,2,4-trichlorobenzene is Clc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1,2,4-trichlorobenzene?
The InChIKey is PBKONEOXTCPAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H.
What are the key properties of 1,2,4-trichlorobenzene?
1,2,4-trichlorobenzene has a molecular weight of 181.45 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trichlorobenzene is sourced from PubChem (CID 13), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).