C6H8O2S2 — CID 13000030
2,2-dimethyl-1,3-dithiane-4,6-dione (PubChem CID 13000030) has the molecular formula C6H8O2S2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dithiane-4,6-dione.
| Compound Name | 2,2-dimethyl-1,3-dithiane-4,6-dione |
|---|---|
| PubChem CID | 13000030 |
| Molecular Formula | C6H8O2S2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 2,2-dimethyl-1,3-dithiane-4,6-dione |
| SMILES | CC1(C)SC(=O)CC(=O)S1 |
| InChI | InChI=1S/C6H8O2S2/c1-6(2)9-4(7)3-5(8)10-6/h3H2,1-2H3 |
| InChIKey | YWWVBEYVWUZUIO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|