About 3-amino-5-ethenyl-2,3-dihydroinden-1-one
3-amino-5-ethenyl-2,3-dihydroinden-1-one (PubChem CID 130001182) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-amino-5-ethenyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 3-amino-5-ethenyl-2,3-dihydroinden-1-one |
| PubChem CID | 130001182 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-amino-5-ethenyl-2,3-dihydroinden-1-one |
| SMILES | C=Cc1ccc2c(c1)C(N)CC2=O |
| InChI | InChI=1S/C11H11NO/c1-2-7-3-4-8-9(5-7)10(12)6-11(8)13/h2-5,10H,1,6,12H2 |
| InChIKey | SMSOSWGYEWHYHX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-5-ethenyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-ethenyl-2,3-dihydroinden-1-one?
The IUPAC name of 3-amino-5-ethenyl-2,3-dihydroinden-1-one (CID 130001182) is 3-amino-5-ethenyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 3-amino-5-ethenyl-2,3-dihydroinden-1-one?
The canonical SMILES for 3-amino-5-ethenyl-2,3-dihydroinden-1-one is C=Cc1ccc2c(c1)C(N)CC2=O.
What is the InChIKey of 3-amino-5-ethenyl-2,3-dihydroinden-1-one?
The InChIKey is SMSOSWGYEWHYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-7-3-4-8-9(5-7)10(12)6-11(8)13/h2-5,10H,1,6,12H2.
What are the key properties of 3-amino-5-ethenyl-2,3-dihydroinden-1-one?
3-amino-5-ethenyl-2,3-dihydroinden-1-one has a molecular weight of 173.21 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-ethenyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 130001182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).