C4H10O — CID 13000132
1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-ol (PubChem CID 13000132) has the molecular formula C4H10O and a molecular weight of 80.16 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 13000132 |
| Molecular Formula | C4H10O |
| Molecular Weight | 80.16 g/mol |
| Exact Mass | 80.11 |
| IUPAC Name | 1,1,1,3,3,3-hexadeuterio-2-methylpropan-2-ol |
| SMILES | [2H]C([2H])([2H])C(C)(O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1D3,2D3 |
| InChIKey | DKGAVHZHDRPRBM-WFGJKAKNSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 80.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |