About 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one
8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one (PubChem CID 13000266) has the molecular formula C13H8ClNO2
and a molecular weight of 245.67 g/mol. Its IUPAC name is 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one |
| PubChem CID | 13000266 |
| Molecular Formula | C13H8ClNO2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one |
| SMILES | O=C1Nc2ccccc2Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H8ClNO2/c14-8-5-6-11-9(7-8)13(16)15-10-3-1-2-4-12(10)17-11/h1-7H,(H,15,16) |
| InChIKey | ZAGINEPNYIZLLO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one?
The IUPAC name of 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one (CID 13000266) is 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one.
What is the SMILES notation for 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one?
The canonical SMILES for 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one is O=C1Nc2ccccc2Oc2ccc(Cl)cc21.
What is the InChIKey of 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one?
The InChIKey is ZAGINEPNYIZLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO2/c14-8-5-6-11-9(7-8)13(16)15-10-3-1-2-4-12(10)17-11/h1-7H,(H,15,16).
What are the key properties of 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one?
8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one has a molecular weight of 245.67 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one is sourced from PubChem (CID 13000266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).