About 2-amino-1,1,2,2-tetradeuterioethanol
2-amino-1,1,2,2-tetradeuterioethanol (PubChem CID 13000300) has the molecular formula C2H7NO
and a molecular weight of 65.11 g/mol. Its IUPAC name is 2-amino-1,1,2,2-tetradeuterioethanol.
Molecular Properties
| Compound Name | 2-amino-1,1,2,2-tetradeuterioethanol |
| PubChem CID | 13000300 |
| Molecular Formula | C2H7NO |
| Molecular Weight | 65.11 g/mol |
| Exact Mass | 65.08 |
| IUPAC Name | 2-amino-1,1,2,2-tetradeuterioethanol |
| SMILES | [2H]C([2H])(N)C([2H])([2H])O |
| InChI | InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2/i1D2,2D2 |
| InChIKey | HZAXFHJVJLSVMW-LNLMKGTHSA-N |
| XLogP | -1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 65.11 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1,1,2,2-tetradeuterioethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,1,2,2-tetradeuterioethanol?
The IUPAC name of 2-amino-1,1,2,2-tetradeuterioethanol (CID 13000300) is 2-amino-1,1,2,2-tetradeuterioethanol.
What is the SMILES notation for 2-amino-1,1,2,2-tetradeuterioethanol?
The canonical SMILES for 2-amino-1,1,2,2-tetradeuterioethanol is [2H]C([2H])(N)C([2H])([2H])O.
What is the InChIKey of 2-amino-1,1,2,2-tetradeuterioethanol?
The InChIKey is HZAXFHJVJLSVMW-LNLMKGTHSA-N. The full InChI is InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2/i1D2,2D2.
What are the key properties of 2-amino-1,1,2,2-tetradeuterioethanol?
2-amino-1,1,2,2-tetradeuterioethanol has a molecular weight of 65.11 g/mol, XLogP of -1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,1,2,2-tetradeuterioethanol is sourced from PubChem (CID 13000300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).