C4H11N — CID 13000365
1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine (PubChem CID 13000365) has the molecular formula C4H11N and a molecular weight of 83.20 g/mol. Its IUPAC name is 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine.
| Compound Name | 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine |
|---|---|
| PubChem CID | 13000365 |
| Molecular Formula | C4H11N |
| Molecular Weight | 83.20 g/mol |
| Exact Mass | 83.15 |
| IUPAC Name | 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H11N/c1-3-5-4-2/h5H,3-4H2,1-2H3/i1D3,2D3,3D2,4D2 |
| InChIKey | HPNMFZURTQLUMO-MWUKXHIBSA-N |
| XLogP | 0.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 83.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |