About 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane
6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 130003825) has the molecular formula C9H12Cl2O
and a molecular weight of 207.10 g/mol. Its IUPAC name is 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 130003825 |
| Molecular Formula | C9H12Cl2O |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | ClCC1C(CCl)C2CC1C1OC21 |
| InChI | InChI=1S/C9H12Cl2O/c10-2-6-4-1-5(7(6)3-11)9-8(4)12-9/h4-9H,1-3H2 |
| InChIKey | GYROWIJUZDVADU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane (CID 130003825) is 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane is ClCC1C(CCl)C2CC1C1OC21.
What is the InChIKey of 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The InChIKey is GYROWIJUZDVADU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2O/c10-2-6-4-1-5(7(6)3-11)9-8(4)12-9/h4-9H,1-3H2.
What are the key properties of 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane?
6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane has a molecular weight of 207.10 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(chloromethyl)-3-oxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 130003825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).