C8H14N2O2 — CID 130004864
5,5-diethyl-1,3-diazinane-4,6-dione (PubChem CID 130004864) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 5,5-diethyl-1,3-diazinane-4,6-dione.
| Compound Name | 5,5-diethyl-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 130004864 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 5,5-diethyl-1,3-diazinane-4,6-dione |
| SMILES | CCC1(CC)C(=O)NCNC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-8(4-2)6(11)9-5-10-7(8)12/h3-5H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | ZYBYARGHUHOOCO-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|