About ethyl propanimidate;hydrochloride
ethyl propanimidate;hydrochloride (PubChem CID 13000588) has the molecular formula C5H12ClNO
and a molecular weight of 137.61 g/mol. Its IUPAC name is ethyl propanimidate;hydrochloride.
Molecular Properties
| Compound Name | ethyl propanimidate;hydrochloride |
| PubChem CID | 13000588 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | ethyl propanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\CC)OCC |
| InChI | InChI=1S/C5H11NO.ClH/c1-3-5(6)7-4-2;/h6H,3-4H2,1-2H3;1H/b6-5+; |
| InChIKey | ATZIPACKTBIFAX-IPZCTEOASA-N |
| XLogP | 1.83 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl propanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl propanimidate;hydrochloride?
The IUPAC name of ethyl propanimidate;hydrochloride (CID 13000588) is ethyl propanimidate;hydrochloride.
What is the SMILES notation for ethyl propanimidate;hydrochloride?
The canonical SMILES for ethyl propanimidate;hydrochloride is Cl.[H]/N=C(\CC)OCC.
What is the InChIKey of ethyl propanimidate;hydrochloride?
The InChIKey is ATZIPACKTBIFAX-IPZCTEOASA-N. The full InChI is InChI=1S/C5H11NO.ClH/c1-3-5(6)7-4-2;/h6H,3-4H2,1-2H3;1H/b6-5+;.
What are the key properties of ethyl propanimidate;hydrochloride?
ethyl propanimidate;hydrochloride has a molecular weight of 137.61 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl propanimidate;hydrochloride is sourced from PubChem (CID 13000588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).