About 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one
2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one (PubChem CID 130005935) has the molecular formula C9H8ClN3O
and a molecular weight of 209.64 g/mol. Its IUPAC name is 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one.
Molecular Properties
| Compound Name | 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one |
| PubChem CID | 130005935 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one |
| SMILES | NC1=Nc2ccc(Cl)cc2C(=O)NC1 |
| InChI | InChI=1S/C9H8ClN3O/c10-5-1-2-7-6(3-5)9(14)12-4-8(11)13-7/h1-3H,4H2,(H2,11,13)(H,12,14) |
| InChIKey | ZBFVKGYOBSKYTM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one?
The IUPAC name of 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one (CID 130005935) is 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one.
What is the SMILES notation for 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one?
The canonical SMILES for 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one is NC1=Nc2ccc(Cl)cc2C(=O)NC1.
What is the InChIKey of 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one?
The InChIKey is ZBFVKGYOBSKYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O/c10-5-1-2-7-6(3-5)9(14)12-4-8(11)13-7/h1-3H,4H2,(H2,11,13)(H,12,14).
What are the key properties of 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one?
2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one has a molecular weight of 209.64 g/mol, XLogP of 1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-chloro-3,4-dihydro-1,4-benzodiazepin-5-one is sourced from PubChem (CID 130005935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).