About 1-benzothiophen-7-yl N-methylcarbamate
1-benzothiophen-7-yl N-methylcarbamate (PubChem CID 130006120) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-benzothiophen-7-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-benzothiophen-7-yl N-methylcarbamate |
| PubChem CID | 130006120 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 1-benzothiophen-7-yl N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccsc12 |
| InChI | InChI=1S/C10H9NO2S/c1-11-10(12)13-8-4-2-3-7-5-6-14-9(7)8/h2-6H,1H3,(H,11,12) |
| InChIKey | WHSADJNGFPMUSH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzothiophen-7-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-7-yl N-methylcarbamate?
The IUPAC name of 1-benzothiophen-7-yl N-methylcarbamate (CID 130006120) is 1-benzothiophen-7-yl N-methylcarbamate.
What is the SMILES notation for 1-benzothiophen-7-yl N-methylcarbamate?
The canonical SMILES for 1-benzothiophen-7-yl N-methylcarbamate is CNC(=O)Oc1cccc2ccsc12.
What is the InChIKey of 1-benzothiophen-7-yl N-methylcarbamate?
The InChIKey is WHSADJNGFPMUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-11-10(12)13-8-4-2-3-7-5-6-14-9(7)8/h2-6H,1H3,(H,11,12).
What are the key properties of 1-benzothiophen-7-yl N-methylcarbamate?
1-benzothiophen-7-yl N-methylcarbamate has a molecular weight of 207.25 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-7-yl N-methylcarbamate is sourced from PubChem (CID 130006120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).