About 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine
6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine (PubChem CID 130006754) has the molecular formula C9H15ClN4
and a molecular weight of 214.70 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine |
| PubChem CID | 130006754 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)cc(NC)n1 |
| InChI | InChI=1S/C9H15ClN4/c1-4-14(5-2)9-12-7(10)6-8(11-3)13-9/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | HARUGHYMNQMZHG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine?
The IUPAC name of 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine (CID 130006754) is 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine?
The canonical SMILES for 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine is CCN(CC)c1nc(Cl)cc(NC)n1.
What is the InChIKey of 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine?
The InChIKey is HARUGHYMNQMZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN4/c1-4-14(5-2)9-12-7(10)6-8(11-3)13-9/h6H,4-5H2,1-3H3,(H,11,12,13).
What are the key properties of 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine?
6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine has a molecular weight of 214.70 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N,2-N-diethyl-4-N-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 130006754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).