C8H13Cl2NO — CID 130006906
3,3-dichloro-5-propan-2-ylpiperidin-2-one (PubChem CID 130006906) has the molecular formula C8H13Cl2NO and a molecular weight of 210.10 g/mol. Its IUPAC name is 3,3-dichloro-5-propan-2-ylpiperidin-2-one.
| Compound Name | 3,3-dichloro-5-propan-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 130006906 |
| Molecular Formula | C8H13Cl2NO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3,3-dichloro-5-propan-2-ylpiperidin-2-one |
| SMILES | CC(C)C1CNC(=O)C(Cl)(Cl)C1 |
| InChI | InChI=1S/C8H13Cl2NO/c1-5(2)6-3-8(9,10)7(12)11-4-6/h5-6H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | CVQFWIQQBJCXCA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|