About [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate
[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate (PubChem CID 130007286) has the molecular formula C10H9N3S
and a molecular weight of 203.27 g/mol. Its IUPAC name is [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate.
Molecular Properties
| Compound Name | [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate |
| PubChem CID | 130007286 |
| Molecular Formula | C10H9N3S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate |
| SMILES | N#CSc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C10H9N3S/c11-7-14-9-3-1-8(2-4-9)10-12-5-6-13-10/h1-4H,5-6H2,(H,12,13) |
| InChIKey | TTXDJZRDBKJGEI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate?
The IUPAC name of [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate (CID 130007286) is [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate.
What is the SMILES notation for [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate?
The canonical SMILES for [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate is N#CSc1ccc(C2=NCCN2)cc1.
What is the InChIKey of [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate?
The InChIKey is TTXDJZRDBKJGEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S/c11-7-14-9-3-1-8(2-4-9)10-12-5-6-13-10/h1-4H,5-6H2,(H,12,13).
What are the key properties of [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate?
[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate has a molecular weight of 203.27 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,5-dihydro-1H-imidazol-2-yl)phenyl] thiocyanate is sourced from PubChem (CID 130007286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).