About 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione
2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (PubChem CID 130007317) has the molecular formula C8H9N3S2
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| PubChem CID | 130007317 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| SMILES | CCCc1nc2c(=S)[nH]cnc2s1 |
| InChI | InChI=1S/C8H9N3S2/c1-2-3-5-11-6-7(12)9-4-10-8(6)13-5/h4H,2-3H2,1H3,(H,9,10,12) |
| InChIKey | YABKKSLFLNABAF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The IUPAC name of 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (CID 130007317) is 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
What is the SMILES notation for 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The canonical SMILES for 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is CCCc1nc2c(=S)[nH]cnc2s1.
What is the InChIKey of 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The InChIKey is YABKKSLFLNABAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S2/c1-2-3-5-11-6-7(12)9-4-10-8(6)13-5/h4H,2-3H2,1H3,(H,9,10,12).
What are the key properties of 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione has a molecular weight of 211.31 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is sourced from PubChem (CID 130007317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).