C7H12ClN3O2 — CID 130007396
7-chloro-1,3,7-triazecane-4,10-dione (PubChem CID 130007396) has the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. Its IUPAC name is 7-chloro-1,3,7-triazecane-4,10-dione.
| Compound Name | 7-chloro-1,3,7-triazecane-4,10-dione |
|---|---|
| PubChem CID | 130007396 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 7-chloro-1,3,7-triazecane-4,10-dione |
| SMILES | O=C1CCN(Cl)CCC(=O)NCN1 |
| InChI | InChI=1S/C7H12ClN3O2/c8-11-3-1-6(12)9-5-10-7(13)2-4-11/h1-5H2,(H,9,12)(H,10,13) |
| InChIKey | MSYQVXJMGICFBP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|