C6H8N4O4 — CID 130007666
1-methyl-3-(2,4,6-trioxo-1,3-diazinan-5-yl)urea (PubChem CID 130007666) has the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. Its IUPAC name is 1-methyl-3-(2,4,6-trioxo-1,3-diazinan-5-yl)urea.
| Compound Name | 1-methyl-3-(2,4,6-trioxo-1,3-diazinan-5-yl)urea |
|---|---|
| PubChem CID | 130007666 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-methyl-3-(2,4,6-trioxo-1,3-diazinan-5-yl)urea |
| SMILES | CNC(=O)NC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N4O4/c1-7-5(13)8-2-3(11)9-6(14)10-4(2)12/h2H,1H3,(H2,7,8,13)(H2,9,10,11,12,14) |
| InChIKey | HHXOJSLYHMIKRU-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|