C8H14N4OS — CID 130008289
4-butyl-5-sulfanylidene-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazol-2-one (PubChem CID 130008289) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-butyl-5-sulfanylidene-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazol-2-one.
| Compound Name | 4-butyl-5-sulfanylidene-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazol-2-one |
|---|---|
| PubChem CID | 130008289 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-butyl-5-sulfanylidene-3,3a,6,6a-tetrahydro-1H-imidazo[4,5-d]imidazol-2-one |
| SMILES | CCCCN1C(=S)NC2NC(=O)NC21 |
| InChI | InChI=1S/C8H14N4OS/c1-2-3-4-12-6-5(10-8(12)14)9-7(13)11-6/h5-6H,2-4H2,1H3,(H,10,14)(H2,9,11,13) |
| InChIKey | CLWBVCFJTHVFIJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|