C13H18N2 — CID 13000841
3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 13000841) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 13000841 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | CN1CCC2(C)c3ccccc3N(C)C12 |
| InChI | InChI=1S/C13H18N2/c1-13-8-9-14(2)12(13)15(3)11-7-5-4-6-10(11)13/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | KLJZEHNRALYISE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |