About 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one
1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one (PubChem CID 130008471) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one |
| PubChem CID | 130008471 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one |
| SMILES | CC1CC(OC(C)C)N(C)C(=O)N1 |
| InChI | InChI=1S/C9H18N2O2/c1-6(2)13-8-5-7(3)10-9(12)11(8)4/h6-8H,5H2,1-4H3,(H,10,12) |
| InChIKey | UMYITGYOYKUTID-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one?
The IUPAC name of 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one (CID 130008471) is 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one.
What is the SMILES notation for 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one?
The canonical SMILES for 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one is CC1CC(OC(C)C)N(C)C(=O)N1.
What is the InChIKey of 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one?
The InChIKey is UMYITGYOYKUTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-6(2)13-8-5-7(3)10-9(12)11(8)4/h6-8H,5H2,1-4H3,(H,10,12).
What are the key properties of 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one?
1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one has a molecular weight of 186.25 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-6-propan-2-yloxy-1,3-diazinan-2-one is sourced from PubChem (CID 130008471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).